C20H19F2N7O2 — CID 3610686
N-[(2,3-difluorophenyl)methyl]-5-nitro-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-amine (PubChem CID 3610686) has the molecular formula C20H19F2N7O2 and a molecular weight of 427.42 g/mol. Its IUPAC name is N-[(2,3-difluorophenyl)methyl]-5-nitro-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-amine.
| Compound Name | N-[(2,3-difluorophenyl)methyl]-5-nitro-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 3610686 |
| Molecular Formula | C20H19F2N7O2 |
| Molecular Weight | 427.42 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | N-[(2,3-difluorophenyl)methyl]-5-nitro-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(NCc2cccc(F)c2F)ncnc1N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C20H19F2N7O2/c21-15-5-3-4-14(17(15)22)12-24-19-18(29(30)31)20(26-13-25-19)28-10-8-27(9-11-28)16-6-1-2-7-23-16/h1-7,13H,8-12H2,(H,24,25,26) |
| InChIKey | IHOYRSDQEFNBJC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 100.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|