C19H23N9O2 — CID 22538395
N-(3-imidazol-1-ylpropyl)-5-nitro-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-amine (PubChem CID 22538395) has the molecular formula C19H23N9O2 and a molecular weight of 409.45 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-5-nitro-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-amine.
| Compound Name | N-(3-imidazol-1-ylpropyl)-5-nitro-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 22538395 |
| Molecular Formula | C19H23N9O2 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-5-nitro-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(NCCCn2ccnc2)ncnc1N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C19H23N9O2/c29-28(30)17-18(22-6-3-8-25-9-7-20-15-25)23-14-24-19(17)27-12-10-26(11-13-27)16-4-1-2-5-21-16/h1-2,4-5,7,9,14-15H,3,6,8,10-13H2,(H,22,23,24) |
| InChIKey | FLTSLYGOBQQYCJ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 118.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|