C20H27N7O4 — CID 3872326
tert-butyl 3-[[5-nitro-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-yl]amino]propanoate (PubChem CID 3872326) has the molecular formula C20H27N7O4 and a molecular weight of 429.48 g/mol. Its IUPAC name is tert-butyl 3-[[5-nitro-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-yl]amino]propanoate.
| Compound Name | tert-butyl 3-[[5-nitro-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-yl]amino]propanoate |
|---|---|
| PubChem CID | 3872326 |
| Molecular Formula | C20H27N7O4 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | tert-butyl 3-[[5-nitro-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-yl]amino]propanoate |
| SMILES | CC(C)(C)OC(=O)CCNc1ncnc(N2CCN(c3ccccn3)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C20H27N7O4/c1-20(2,3)31-16(28)7-9-22-18-17(27(29)30)19(24-14-23-18)26-12-10-25(11-13-26)15-6-4-5-8-21-15/h4-6,8,14H,7,9-13H2,1-3H3,(H,22,23,24) |
| InChIKey | PULWDYZWDVCYBF-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 126.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|