C22H26ClN5O4 — CID 3733267
tert-butyl 3-[[6-[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-5-nitropyrimidin-4-yl]amino]propanoate (PubChem CID 3733267) has the molecular formula C22H26ClN5O4 and a molecular weight of 459.93 g/mol. Its IUPAC name is tert-butyl 3-[[6-[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-5-nitropyrimidin-4-yl]amino]propanoate.
| Compound Name | tert-butyl 3-[[6-[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-5-nitropyrimidin-4-yl]amino]propanoate |
|---|---|
| PubChem CID | 3733267 |
| Molecular Formula | C22H26ClN5O4 |
| Molecular Weight | 459.93 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | tert-butyl 3-[[6-[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-5-nitropyrimidin-4-yl]amino]propanoate |
| SMILES | CC(C)(C)OC(=O)CCNc1ncnc(N2CC=C(c3ccc(Cl)cc3)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C22H26ClN5O4/c1-22(2,3)32-18(29)8-11-24-20-19(28(30)31)21(26-14-25-20)27-12-9-16(10-13-27)15-4-6-17(23)7-5-15/h4-7,9,14H,8,10-13H2,1-3H3,(H,24,25,26) |
| InChIKey | IHKUXCVRXIXRNX-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 110.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.93 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|