C27H32N6O4 — CID 3711619
benzyl 5-[[6-(4-benzylpiperazin-1-yl)-5-nitropyrimidin-4-yl]amino]pentanoate (PubChem CID 3711619) has the molecular formula C27H32N6O4 and a molecular weight of 504.59 g/mol. Its IUPAC name is benzyl 5-[[6-(4-benzylpiperazin-1-yl)-5-nitropyrimidin-4-yl]amino]pentanoate.
| Compound Name | benzyl 5-[[6-(4-benzylpiperazin-1-yl)-5-nitropyrimidin-4-yl]amino]pentanoate |
|---|---|
| PubChem CID | 3711619 |
| Molecular Formula | C27H32N6O4 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | benzyl 5-[[6-(4-benzylpiperazin-1-yl)-5-nitropyrimidin-4-yl]amino]pentanoate |
| SMILES | O=C(CCCCNc1ncnc(N2CCN(Cc3ccccc3)CC2)c1[N+](=O)[O-])OCc1ccccc1 |
| InChI | InChI=1S/C27H32N6O4/c34-24(37-20-23-11-5-2-6-12-23)13-7-8-14-28-26-25(33(35)36)27(30-21-29-26)32-17-15-31(16-18-32)19-22-9-3-1-4-10-22/h1-6,9-12,21H,7-8,13-20H2,(H,28,29,30) |
| InChIKey | AKBJPHSAVMYNCJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|