C23H23Cl2N7O4 — CID 23491273
N'-[6-(4-benzylpiperazin-1-yl)-5-nitropyrimidin-4-yl]-2-(2,4-dichlorophenoxy)acetohydrazide (PubChem CID 23491273) has the molecular formula C23H23Cl2N7O4 and a molecular weight of 532.39 g/mol. Its IUPAC name is N'-[6-(4-benzylpiperazin-1-yl)-5-nitropyrimidin-4-yl]-2-(2,4-dichlorophenoxy)acetohydrazide.
| Compound Name | N'-[6-(4-benzylpiperazin-1-yl)-5-nitropyrimidin-4-yl]-2-(2,4-dichlorophenoxy)acetohydrazide |
|---|---|
| PubChem CID | 23491273 |
| Molecular Formula | C23H23Cl2N7O4 |
| Molecular Weight | 532.39 g/mol |
| Exact Mass | 531.12 |
| IUPAC Name | N'-[6-(4-benzylpiperazin-1-yl)-5-nitropyrimidin-4-yl]-2-(2,4-dichlorophenoxy)acetohydrazide |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)NNc1ncnc(N2CCN(Cc3ccccc3)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C23H23Cl2N7O4/c24-17-6-7-19(18(25)12-17)36-14-20(33)28-29-22-21(32(34)35)23(27-15-26-22)31-10-8-30(9-11-31)13-16-4-2-1-3-5-16/h1-7,12,15H,8-11,13-14H2,(H,28,33)(H,26,27,29) |
| InChIKey | GKELOOSGYBEBKO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 125.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.39 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|