C18H13Cl3N6O4 — CID 22532988
N'-[6-(4-chloroanilino)-5-nitropyrimidin-4-yl]-2-(2,4-dichlorophenoxy)acetohydrazide (PubChem CID 22532988) has the molecular formula C18H13Cl3N6O4 and a molecular weight of 483.70 g/mol. Its IUPAC name is N'-[6-(4-chloroanilino)-5-nitropyrimidin-4-yl]-2-(2,4-dichlorophenoxy)acetohydrazide.
| Compound Name | N'-[6-(4-chloroanilino)-5-nitropyrimidin-4-yl]-2-(2,4-dichlorophenoxy)acetohydrazide |
|---|---|
| PubChem CID | 22532988 |
| Molecular Formula | C18H13Cl3N6O4 |
| Molecular Weight | 483.70 g/mol |
| Exact Mass | 482.01 |
| IUPAC Name | N'-[6-(4-chloroanilino)-5-nitropyrimidin-4-yl]-2-(2,4-dichlorophenoxy)acetohydrazide |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)NNc1ncnc(Nc2ccc(Cl)cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H13Cl3N6O4/c19-10-1-4-12(5-2-10)24-17-16(27(29)30)18(23-9-22-17)26-25-15(28)8-31-14-6-3-11(20)7-13(14)21/h1-7,9H,8H2,(H,25,28)(H2,22,23,24,26) |
| InChIKey | XLVNRYNQDXUEQF-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 131.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.70 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|