C20H20Cl2N6O3 — CID 19149232
N'-[5-amino-6-(4-ethoxyanilino)pyrimidin-4-yl]-2-(2,4-dichlorophenoxy)acetohydrazide (PubChem CID 19149232) has the molecular formula C20H20Cl2N6O3 and a molecular weight of 463.33 g/mol. Its IUPAC name is N'-[5-amino-6-(4-ethoxyanilino)pyrimidin-4-yl]-2-(2,4-dichlorophenoxy)acetohydrazide.
| Compound Name | N'-[5-amino-6-(4-ethoxyanilino)pyrimidin-4-yl]-2-(2,4-dichlorophenoxy)acetohydrazide |
|---|---|
| PubChem CID | 19149232 |
| Molecular Formula | C20H20Cl2N6O3 |
| Molecular Weight | 463.33 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | N'-[5-amino-6-(4-ethoxyanilino)pyrimidin-4-yl]-2-(2,4-dichlorophenoxy)acetohydrazide |
| SMILES | CCOc1ccc(Nc2ncnc(NNC(=O)COc3ccc(Cl)cc3Cl)c2N)cc1 |
| InChI | InChI=1S/C20H20Cl2N6O3/c1-2-30-14-6-4-13(5-7-14)26-19-18(23)20(25-11-24-19)28-27-17(29)10-31-16-8-3-12(21)9-15(16)22/h3-9,11H,2,10,23H2,1H3,(H,27,29)(H2,24,25,26,28) |
| InChIKey | CHWSJEKHLTUMJS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 123.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.33 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|