C19H14Cl3F3N6O2 — CID 19152376
N'-[5-amino-6-[4-chloro-3-(trifluoromethyl)anilino]pyrimidin-4-yl]-2-(2,4-dichlorophenoxy)acetohydrazide (PubChem CID 19152376) has the molecular formula C19H14Cl3F3N6O2 and a molecular weight of 521.71 g/mol. Its IUPAC name is N'-[5-amino-6-[4-chloro-3-(trifluoromethyl)anilino]pyrimidin-4-yl]-2-(2,4-dichlorophenoxy)acetohydrazide.
| Compound Name | N'-[5-amino-6-[4-chloro-3-(trifluoromethyl)anilino]pyrimidin-4-yl]-2-(2,4-dichlorophenoxy)acetohydrazide |
|---|---|
| PubChem CID | 19152376 |
| Molecular Formula | C19H14Cl3F3N6O2 |
| Molecular Weight | 521.71 g/mol |
| Exact Mass | 520.02 |
| IUPAC Name | N'-[5-amino-6-[4-chloro-3-(trifluoromethyl)anilino]pyrimidin-4-yl]-2-(2,4-dichlorophenoxy)acetohydrazide |
| SMILES | Nc1c(NNC(=O)COc2ccc(Cl)cc2Cl)ncnc1Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H14Cl3F3N6O2/c20-9-1-4-14(13(22)5-9)33-7-15(32)30-31-18-16(26)17(27-8-28-18)29-10-2-3-12(21)11(6-10)19(23,24)25/h1-6,8H,7,26H2,(H,30,32)(H2,27,28,29,31) |
| InChIKey | GMUUQUQEYUSMRT-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.71 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|