C16H20Cl2N6O2 — CID 19134901
N'-[5-amino-6-(butylamino)pyrimidin-4-yl]-2-(2,4-dichlorophenoxy)acetohydrazide (PubChem CID 19134901) has the molecular formula C16H20Cl2N6O2 and a molecular weight of 399.28 g/mol. Its IUPAC name is N'-[5-amino-6-(butylamino)pyrimidin-4-yl]-2-(2,4-dichlorophenoxy)acetohydrazide.
| Compound Name | N'-[5-amino-6-(butylamino)pyrimidin-4-yl]-2-(2,4-dichlorophenoxy)acetohydrazide |
|---|---|
| PubChem CID | 19134901 |
| Molecular Formula | C16H20Cl2N6O2 |
| Molecular Weight | 399.28 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | N'-[5-amino-6-(butylamino)pyrimidin-4-yl]-2-(2,4-dichlorophenoxy)acetohydrazide |
| SMILES | CCCCNc1ncnc(NNC(=O)COc2ccc(Cl)cc2Cl)c1N |
| InChI | InChI=1S/C16H20Cl2N6O2/c1-2-3-6-20-15-14(19)16(22-9-21-15)24-23-13(25)8-26-12-5-4-10(17)7-11(12)18/h4-5,7,9H,2-3,6,8,19H2,1H3,(H,23,25)(H2,20,21,22,24) |
| InChIKey | RZBMRGGSRUFWPG-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.28 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|