C18H18Cl2N8O2 — CID 19141504
N'-[5-amino-6-[bis(2-cyanoethyl)amino]pyrimidin-4-yl]-2-(2,4-dichlorophenoxy)acetohydrazide (PubChem CID 19141504) has the molecular formula C18H18Cl2N8O2 and a molecular weight of 449.30 g/mol. Its IUPAC name is N'-[5-amino-6-[bis(2-cyanoethyl)amino]pyrimidin-4-yl]-2-(2,4-dichlorophenoxy)acetohydrazide.
| Compound Name | N'-[5-amino-6-[bis(2-cyanoethyl)amino]pyrimidin-4-yl]-2-(2,4-dichlorophenoxy)acetohydrazide |
|---|---|
| PubChem CID | 19141504 |
| Molecular Formula | C18H18Cl2N8O2 |
| Molecular Weight | 449.30 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | N'-[5-amino-6-[bis(2-cyanoethyl)amino]pyrimidin-4-yl]-2-(2,4-dichlorophenoxy)acetohydrazide |
| SMILES | N#CCCN(CCC#N)c1ncnc(NNC(=O)COc2ccc(Cl)cc2Cl)c1N |
| InChI | InChI=1S/C18H18Cl2N8O2/c19-12-3-4-14(13(20)9-12)30-10-15(29)26-27-17-16(23)18(25-11-24-17)28(7-1-5-21)8-2-6-22/h3-4,9,11H,1-2,7-8,10,23H2,(H,26,29)(H,24,25,27) |
| InChIKey | ZAKXNCDCNVZICO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 152.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.30 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|