C22H24Cl2N6O4 — CID 22541725
N'-[5-amino-6-[2-(3,4-dimethoxyphenyl)ethylamino]pyrimidin-4-yl]-2-(2,4-dichlorophenoxy)acetohydrazide (PubChem CID 22541725) has the molecular formula C22H24Cl2N6O4 and a molecular weight of 507.38 g/mol. Its IUPAC name is N'-[5-amino-6-[2-(3,4-dimethoxyphenyl)ethylamino]pyrimidin-4-yl]-2-(2,4-dichlorophenoxy)acetohydrazide.
| Compound Name | N'-[5-amino-6-[2-(3,4-dimethoxyphenyl)ethylamino]pyrimidin-4-yl]-2-(2,4-dichlorophenoxy)acetohydrazide |
|---|---|
| PubChem CID | 22541725 |
| Molecular Formula | C22H24Cl2N6O4 |
| Molecular Weight | 507.38 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | N'-[5-amino-6-[2-(3,4-dimethoxyphenyl)ethylamino]pyrimidin-4-yl]-2-(2,4-dichlorophenoxy)acetohydrazide |
| SMILES | COc1ccc(CCNc2ncnc(NNC(=O)COc3ccc(Cl)cc3Cl)c2N)cc1OC |
| InChI | InChI=1S/C22H24Cl2N6O4/c1-32-17-5-3-13(9-18(17)33-2)7-8-26-21-20(25)22(28-12-27-21)30-29-19(31)11-34-16-6-4-14(23)10-15(16)24/h3-6,9-10,12H,7-8,11,25H2,1-2H3,(H,29,31)(H2,26,27,28,30) |
| InChIKey | OWBULTJVXFVYRK-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 132.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|