C21H23FN6O3 — CID 22541708
N'-[5-amino-6-[2-(3,4-dimethoxyphenyl)ethylamino]pyrimidin-4-yl]-4-fluorobenzohydrazide (PubChem CID 22541708) has the molecular formula C21H23FN6O3 and a molecular weight of 426.45 g/mol. Its IUPAC name is N'-[5-amino-6-[2-(3,4-dimethoxyphenyl)ethylamino]pyrimidin-4-yl]-4-fluorobenzohydrazide.
| Compound Name | N'-[5-amino-6-[2-(3,4-dimethoxyphenyl)ethylamino]pyrimidin-4-yl]-4-fluorobenzohydrazide |
|---|---|
| PubChem CID | 22541708 |
| Molecular Formula | C21H23FN6O3 |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | N'-[5-amino-6-[2-(3,4-dimethoxyphenyl)ethylamino]pyrimidin-4-yl]-4-fluorobenzohydrazide |
| SMILES | COc1ccc(CCNc2ncnc(NNC(=O)c3ccc(F)cc3)c2N)cc1OC |
| InChI | InChI=1S/C21H23FN6O3/c1-30-16-8-3-13(11-17(16)31-2)9-10-24-19-18(23)20(26-12-25-19)27-28-21(29)14-4-6-15(22)7-5-14/h3-8,11-12H,9-10,23H2,1-2H3,(H,28,29)(H2,24,25,26,27) |
| InChIKey | PANHKNNFEUZQJU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 123.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|