C20H21N7O5 — CID 23480210
N'-[6-[2-(3,4-dimethoxyphenyl)ethylamino]-5-nitropyrimidin-4-yl]pyridine-3-carbohydrazide (PubChem CID 23480210) has the molecular formula C20H21N7O5 and a molecular weight of 439.43 g/mol. Its IUPAC name is N'-[6-[2-(3,4-dimethoxyphenyl)ethylamino]-5-nitropyrimidin-4-yl]pyridine-3-carbohydrazide.
| Compound Name | N'-[6-[2-(3,4-dimethoxyphenyl)ethylamino]-5-nitropyrimidin-4-yl]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 23480210 |
| Molecular Formula | C20H21N7O5 |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | N'-[6-[2-(3,4-dimethoxyphenyl)ethylamino]-5-nitropyrimidin-4-yl]pyridine-3-carbohydrazide |
| SMILES | COc1ccc(CCNc2ncnc(NNC(=O)c3cccnc3)c2[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C20H21N7O5/c1-31-15-6-5-13(10-16(15)32-2)7-9-22-18-17(27(29)30)19(24-12-23-18)25-26-20(28)14-4-3-8-21-11-14/h3-6,8,10-12H,7,9H2,1-2H3,(H,26,28)(H2,22,23,24,25) |
| InChIKey | YEFQAGADTOOGTD-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 153.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|