C18H21N7O3 — CID 22525943
N'-[6-[2-(cyclohexen-1-yl)ethylamino]-5-nitropyrimidin-4-yl]pyridine-3-carbohydrazide (PubChem CID 22525943) has the molecular formula C18H21N7O3 and a molecular weight of 383.41 g/mol. Its IUPAC name is N'-[6-[2-(cyclohexen-1-yl)ethylamino]-5-nitropyrimidin-4-yl]pyridine-3-carbohydrazide.
| Compound Name | N'-[6-[2-(cyclohexen-1-yl)ethylamino]-5-nitropyrimidin-4-yl]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 22525943 |
| Molecular Formula | C18H21N7O3 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | N'-[6-[2-(cyclohexen-1-yl)ethylamino]-5-nitropyrimidin-4-yl]pyridine-3-carbohydrazide |
| SMILES | O=C(NNc1ncnc(NCCC2=CCCCC2)c1[N+](=O)[O-])c1cccnc1 |
| InChI | InChI=1S/C18H21N7O3/c26-18(14-7-4-9-19-11-14)24-23-17-15(25(27)28)16(21-12-22-17)20-10-8-13-5-2-1-3-6-13/h4-5,7,9,11-12H,1-3,6,8,10H2,(H,24,26)(H2,20,21,22,23) |
| InChIKey | WZCSXSXNACGZAL-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 134.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|