C16H20N8O4 — CID 22536657
N'-[6-(2-morpholin-4-ylethylamino)-5-nitropyrimidin-4-yl]pyridine-3-carbohydrazide (PubChem CID 22536657) has the molecular formula C16H20N8O4 and a molecular weight of 388.39 g/mol. Its IUPAC name is N'-[6-(2-morpholin-4-ylethylamino)-5-nitropyrimidin-4-yl]pyridine-3-carbohydrazide.
| Compound Name | N'-[6-(2-morpholin-4-ylethylamino)-5-nitropyrimidin-4-yl]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 22536657 |
| Molecular Formula | C16H20N8O4 |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | N'-[6-(2-morpholin-4-ylethylamino)-5-nitropyrimidin-4-yl]pyridine-3-carbohydrazide |
| SMILES | O=C(NNc1ncnc(NCCN2CCOCC2)c1[N+](=O)[O-])c1cccnc1 |
| InChI | InChI=1S/C16H20N8O4/c25-16(12-2-1-3-17-10-12)22-21-15-13(24(26)27)14(19-11-20-15)18-4-5-23-6-8-28-9-7-23/h1-3,10-11H,4-9H2,(H,22,25)(H2,18,19,20,21) |
| InChIKey | ZLYNZSZUJBYFCC-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 147.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|