C14H25N7O3 — CID 22537557
6-(2-tert-butylhydrazinyl)-N-(2-morpholin-4-ylethyl)-5-nitropyrimidin-4-amine (PubChem CID 22537557) has the molecular formula C14H25N7O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is 6-(2-tert-butylhydrazinyl)-N-(2-morpholin-4-ylethyl)-5-nitropyrimidin-4-amine.
| Compound Name | 6-(2-tert-butylhydrazinyl)-N-(2-morpholin-4-ylethyl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 22537557 |
| Molecular Formula | C14H25N7O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | 6-(2-tert-butylhydrazinyl)-N-(2-morpholin-4-ylethyl)-5-nitropyrimidin-4-amine |
| SMILES | CC(C)(C)NNc1ncnc(NCCN2CCOCC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H25N7O3/c1-14(2,3)19-18-13-11(21(22)23)12(16-10-17-13)15-4-5-20-6-8-24-9-7-20/h10,19H,4-9H2,1-3H3,(H2,15,16,17,18) |
| InChIKey | MSTUNVUCQYVIDM-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 117.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|