C18H22N8O5 — CID 22526083
2-nitro-N'-[5-nitro-6-(2-piperidin-1-ylethylamino)pyrimidin-4-yl]benzohydrazide (PubChem CID 22526083) has the molecular formula C18H22N8O5 and a molecular weight of 430.43 g/mol. Its IUPAC name is 2-nitro-N'-[5-nitro-6-(2-piperidin-1-ylethylamino)pyrimidin-4-yl]benzohydrazide.
| Compound Name | 2-nitro-N'-[5-nitro-6-(2-piperidin-1-ylethylamino)pyrimidin-4-yl]benzohydrazide |
|---|---|
| PubChem CID | 22526083 |
| Molecular Formula | C18H22N8O5 |
| Molecular Weight | 430.43 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 2-nitro-N'-[5-nitro-6-(2-piperidin-1-ylethylamino)pyrimidin-4-yl]benzohydrazide |
| SMILES | O=C(NNc1ncnc(NCCN2CCCCC2)c1[N+](=O)[O-])c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H22N8O5/c27-18(13-6-2-3-7-14(13)25(28)29)23-22-17-15(26(30)31)16(20-12-21-17)19-8-11-24-9-4-1-5-10-24/h2-3,6-7,12H,1,4-5,8-11H2,(H,23,27)(H2,19,20,21,22) |
| InChIKey | QXCUHWFOOIHBLU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 168.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.43 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|