C17H21BrN6O2 — CID 22526114
4-N-(3-bromophenyl)-5-nitro-6-N-(2-piperidin-1-ylethyl)pyrimidine-4,6-diamine (PubChem CID 22526114) has the molecular formula C17H21BrN6O2 and a molecular weight of 421.30 g/mol. Its IUPAC name is 4-N-(3-bromophenyl)-5-nitro-6-N-(2-piperidin-1-ylethyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N-(3-bromophenyl)-5-nitro-6-N-(2-piperidin-1-ylethyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22526114 |
| Molecular Formula | C17H21BrN6O2 |
| Molecular Weight | 421.30 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | 4-N-(3-bromophenyl)-5-nitro-6-N-(2-piperidin-1-ylethyl)pyrimidine-4,6-diamine |
| SMILES | O=[N+]([O-])c1c(NCCN2CCCCC2)ncnc1Nc1cccc(Br)c1 |
| InChI | InChI=1S/C17H21BrN6O2/c18-13-5-4-6-14(11-13)22-17-15(24(25)26)16(20-12-21-17)19-7-10-23-8-2-1-3-9-23/h4-6,11-12H,1-3,7-10H2,(H2,19,20,21,22) |
| InChIKey | RFWKBWYNIRILCE-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.30 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|