C18H23ClN6O2 — CID 22526145
4-N-[(2-chlorophenyl)methyl]-5-nitro-6-N-(2-piperidin-1-ylethyl)pyrimidine-4,6-diamine (PubChem CID 22526145) has the molecular formula C18H23ClN6O2 and a molecular weight of 390.88 g/mol. Its IUPAC name is 4-N-[(2-chlorophenyl)methyl]-5-nitro-6-N-(2-piperidin-1-ylethyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N-[(2-chlorophenyl)methyl]-5-nitro-6-N-(2-piperidin-1-ylethyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22526145 |
| Molecular Formula | C18H23ClN6O2 |
| Molecular Weight | 390.88 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 4-N-[(2-chlorophenyl)methyl]-5-nitro-6-N-(2-piperidin-1-ylethyl)pyrimidine-4,6-diamine |
| SMILES | O=[N+]([O-])c1c(NCCN2CCCCC2)ncnc1NCc1ccccc1Cl |
| InChI | InChI=1S/C18H23ClN6O2/c19-15-7-3-2-6-14(15)12-21-18-16(25(26)27)17(22-13-23-18)20-8-11-24-9-4-1-5-10-24/h2-3,6-7,13H,1,4-5,8-12H2,(H2,20,21,22,23) |
| InChIKey | VPDOUHUQYIGXAG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.88 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|