C18H15Cl2N5O2 — CID 22538950
4-N,6-N-bis[(2-chlorophenyl)methyl]-5-nitropyrimidine-4,6-diamine (PubChem CID 22538950) has the molecular formula C18H15Cl2N5O2 and a molecular weight of 404.26 g/mol. Its IUPAC name is 4-N,6-N-bis[(2-chlorophenyl)methyl]-5-nitropyrimidine-4,6-diamine.
| Compound Name | 4-N,6-N-bis[(2-chlorophenyl)methyl]-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22538950 |
| Molecular Formula | C18H15Cl2N5O2 |
| Molecular Weight | 404.26 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | 4-N,6-N-bis[(2-chlorophenyl)methyl]-5-nitropyrimidine-4,6-diamine |
| SMILES | O=[N+]([O-])c1c(NCc2ccccc2Cl)ncnc1NCc1ccccc1Cl |
| InChI | InChI=1S/C18H15Cl2N5O2/c19-14-7-3-1-5-12(14)9-21-17-16(25(26)27)18(24-11-23-17)22-10-13-6-2-4-8-15(13)20/h1-8,11H,9-10H2,(H2,21,22,23,24) |
| InChIKey | DCRVHYDASPQWCT-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 92.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.26 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|