C16H13ClN6O4 — CID 22536805
N'-[6-[(2-chlorophenyl)methylamino]-5-nitropyrimidin-4-yl]furan-2-carbohydrazide (PubChem CID 22536805) has the molecular formula C16H13ClN6O4 and a molecular weight of 388.77 g/mol. Its IUPAC name is N'-[6-[(2-chlorophenyl)methylamino]-5-nitropyrimidin-4-yl]furan-2-carbohydrazide.
| Compound Name | N'-[6-[(2-chlorophenyl)methylamino]-5-nitropyrimidin-4-yl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 22536805 |
| Molecular Formula | C16H13ClN6O4 |
| Molecular Weight | 388.77 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | N'-[6-[(2-chlorophenyl)methylamino]-5-nitropyrimidin-4-yl]furan-2-carbohydrazide |
| SMILES | O=C(NNc1ncnc(NCc2ccccc2Cl)c1[N+](=O)[O-])c1ccco1 |
| InChI | InChI=1S/C16H13ClN6O4/c17-11-5-2-1-4-10(11)8-18-14-13(23(25)26)15(20-9-19-14)21-22-16(24)12-6-3-7-27-12/h1-7,9H,8H2,(H,22,24)(H2,18,19,20,21) |
| InChIKey | HOYCZLIILAEVBG-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 135.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.77 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|