C13H16N6O5 — CID 22526553
N'-[6-(3-methoxypropylamino)-5-nitropyrimidin-4-yl]furan-2-carbohydrazide (PubChem CID 22526553) has the molecular formula C13H16N6O5 and a molecular weight of 336.31 g/mol. Its IUPAC name is N'-[6-(3-methoxypropylamino)-5-nitropyrimidin-4-yl]furan-2-carbohydrazide.
| Compound Name | N'-[6-(3-methoxypropylamino)-5-nitropyrimidin-4-yl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 22526553 |
| Molecular Formula | C13H16N6O5 |
| Molecular Weight | 336.31 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | N'-[6-(3-methoxypropylamino)-5-nitropyrimidin-4-yl]furan-2-carbohydrazide |
| SMILES | COCCCNc1ncnc(NNC(=O)c2ccco2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H16N6O5/c1-23-6-3-5-14-11-10(19(21)22)12(16-8-15-11)17-18-13(20)9-4-2-7-24-9/h2,4,7-8H,3,5-6H2,1H3,(H,18,20)(H2,14,15,16,17) |
| InChIKey | MICCKHGMLWFNLF-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 144.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.31 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|