C19H16N6O8 — CID 23486384
dimethyl 5-[[6-[2-(furan-2-carbonyl)hydrazinyl]-5-nitropyrimidin-4-yl]amino]benzene-1,3-dicarboxylate (PubChem CID 23486384) has the molecular formula C19H16N6O8 and a molecular weight of 456.37 g/mol. Its IUPAC name is dimethyl 5-[[6-[2-(furan-2-carbonyl)hydrazinyl]-5-nitropyrimidin-4-yl]amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[6-[2-(furan-2-carbonyl)hydrazinyl]-5-nitropyrimidin-4-yl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 23486384 |
| Molecular Formula | C19H16N6O8 |
| Molecular Weight | 456.37 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | dimethyl 5-[[6-[2-(furan-2-carbonyl)hydrazinyl]-5-nitropyrimidin-4-yl]amino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(Nc2ncnc(NNC(=O)c3ccco3)c2[N+](=O)[O-])cc(C(=O)OC)c1 |
| InChI | InChI=1S/C19H16N6O8/c1-31-18(27)10-6-11(19(28)32-2)8-12(7-10)22-15-14(25(29)30)16(21-9-20-15)23-24-17(26)13-4-3-5-33-13/h3-9H,1-2H3,(H,24,26)(H2,20,21,22,23) |
| InChIKey | GYUDMIBFHODUAT-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 187.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.37 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|