C15H10Cl2N6O4 — CID 23485550
N'-[6-(3,4-dichloroanilino)-5-nitropyrimidin-4-yl]furan-2-carbohydrazide (PubChem CID 23485550) has the molecular formula C15H10Cl2N6O4 and a molecular weight of 409.19 g/mol. Its IUPAC name is N'-[6-(3,4-dichloroanilino)-5-nitropyrimidin-4-yl]furan-2-carbohydrazide.
| Compound Name | N'-[6-(3,4-dichloroanilino)-5-nitropyrimidin-4-yl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 23485550 |
| Molecular Formula | C15H10Cl2N6O4 |
| Molecular Weight | 409.19 g/mol |
| Exact Mass | 408.01 |
| IUPAC Name | N'-[6-(3,4-dichloroanilino)-5-nitropyrimidin-4-yl]furan-2-carbohydrazide |
| SMILES | O=C(NNc1ncnc(Nc2ccc(Cl)c(Cl)c2)c1[N+](=O)[O-])c1ccco1 |
| InChI | InChI=1S/C15H10Cl2N6O4/c16-9-4-3-8(6-10(9)17)20-13-12(23(25)26)14(19-7-18-13)21-22-15(24)11-2-1-5-27-11/h1-7H,(H,22,24)(H2,18,19,20,21) |
| InChIKey | ROWAWMIZDKJHBV-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 135.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.19 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|