C15H11N5O4S — CID 22534044
N'-(5-nitro-6-phenylsulfanylpyrimidin-4-yl)furan-2-carbohydrazide (PubChem CID 22534044) has the molecular formula C15H11N5O4S and a molecular weight of 357.35 g/mol. Its IUPAC name is N'-(5-nitro-6-phenylsulfanylpyrimidin-4-yl)furan-2-carbohydrazide.
| Compound Name | N'-(5-nitro-6-phenylsulfanylpyrimidin-4-yl)furan-2-carbohydrazide |
|---|---|
| PubChem CID | 22534044 |
| Molecular Formula | C15H11N5O4S |
| Molecular Weight | 357.35 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | N'-(5-nitro-6-phenylsulfanylpyrimidin-4-yl)furan-2-carbohydrazide |
| SMILES | O=C(NNc1ncnc(Sc2ccccc2)c1[N+](=O)[O-])c1ccco1 |
| InChI | InChI=1S/C15H11N5O4S/c21-14(11-7-4-8-24-11)19-18-13-12(20(22)23)15(17-9-16-13)25-10-5-2-1-3-6-10/h1-9H,(H,19,21)(H,16,17,18) |
| InChIKey | ZSVPYJFKRMZPEX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|