C17H14N6O4 — CID 23481821
N'-[6-(2,3-dihydroindol-1-yl)-5-nitropyrimidin-4-yl]furan-2-carbohydrazide (PubChem CID 23481821) has the molecular formula C17H14N6O4 and a molecular weight of 366.34 g/mol. Its IUPAC name is N'-[6-(2,3-dihydroindol-1-yl)-5-nitropyrimidin-4-yl]furan-2-carbohydrazide.
| Compound Name | N'-[6-(2,3-dihydroindol-1-yl)-5-nitropyrimidin-4-yl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 23481821 |
| Molecular Formula | C17H14N6O4 |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | N'-[6-(2,3-dihydroindol-1-yl)-5-nitropyrimidin-4-yl]furan-2-carbohydrazide |
| SMILES | O=C(NNc1ncnc(N2CCc3ccccc32)c1[N+](=O)[O-])c1ccco1 |
| InChI | InChI=1S/C17H14N6O4/c24-17(13-6-3-9-27-13)21-20-15-14(23(25)26)16(19-10-18-15)22-8-7-11-4-1-2-5-12(11)22/h1-6,9-10H,7-8H2,(H,21,24)(H,18,19,20) |
| InChIKey | HLMNHSVQIFQCJF-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 126.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|