C20H17FN6O3 — CID 22531446
N'-[6-(3,4-dihydro-2H-quinolin-1-yl)-5-nitropyrimidin-4-yl]-2-fluorobenzohydrazide (PubChem CID 22531446) has the molecular formula C20H17FN6O3 and a molecular weight of 408.39 g/mol. Its IUPAC name is N'-[6-(3,4-dihydro-2H-quinolin-1-yl)-5-nitropyrimidin-4-yl]-2-fluorobenzohydrazide.
| Compound Name | N'-[6-(3,4-dihydro-2H-quinolin-1-yl)-5-nitropyrimidin-4-yl]-2-fluorobenzohydrazide |
|---|---|
| PubChem CID | 22531446 |
| Molecular Formula | C20H17FN6O3 |
| Molecular Weight | 408.39 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | N'-[6-(3,4-dihydro-2H-quinolin-1-yl)-5-nitropyrimidin-4-yl]-2-fluorobenzohydrazide |
| SMILES | O=C(NNc1ncnc(N2CCCc3ccccc32)c1[N+](=O)[O-])c1ccccc1F |
| InChI | InChI=1S/C20H17FN6O3/c21-15-9-3-2-8-14(15)20(28)25-24-18-17(27(29)30)19(23-12-22-18)26-11-5-7-13-6-1-4-10-16(13)26/h1-4,6,8-10,12H,5,7,11H2,(H,25,28)(H,22,23,24) |
| InChIKey | CEOXKMSLWNXNIS-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|