C21H21N5O2 — CID 23484858
6-(3,4-dihydro-2H-quinolin-1-yl)-N-(3,4-dimethylphenyl)-5-nitropyrimidin-4-amine (PubChem CID 23484858) has the molecular formula C21H21N5O2 and a molecular weight of 375.43 g/mol. Its IUPAC name is 6-(3,4-dihydro-2H-quinolin-1-yl)-N-(3,4-dimethylphenyl)-5-nitropyrimidin-4-amine.
| Compound Name | 6-(3,4-dihydro-2H-quinolin-1-yl)-N-(3,4-dimethylphenyl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 23484858 |
| Molecular Formula | C21H21N5O2 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 6-(3,4-dihydro-2H-quinolin-1-yl)-N-(3,4-dimethylphenyl)-5-nitropyrimidin-4-amine |
| SMILES | Cc1ccc(Nc2ncnc(N3CCCc4ccccc43)c2[N+](=O)[O-])cc1C |
| InChI | InChI=1S/C21H21N5O2/c1-14-9-10-17(12-15(14)2)24-20-19(26(27)28)21(23-13-22-20)25-11-5-7-16-6-3-4-8-18(16)25/h3-4,6,8-10,12-13H,5,7,11H2,1-2H3,(H,22,23,24) |
| InChIKey | VGGSHWXJOQUTOA-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 84.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|