C22H21N5O2 — CID 22531404
1-[6-(3,4-dihydro-2H-quinolin-1-yl)-5-nitropyrimidin-4-yl]-3,4-dihydro-2H-quinoline (PubChem CID 22531404) has the molecular formula C22H21N5O2 and a molecular weight of 387.44 g/mol. Its IUPAC name is 1-[6-(3,4-dihydro-2H-quinolin-1-yl)-5-nitropyrimidin-4-yl]-3,4-dihydro-2H-quinoline.
| Compound Name | 1-[6-(3,4-dihydro-2H-quinolin-1-yl)-5-nitropyrimidin-4-yl]-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 22531404 |
| Molecular Formula | C22H21N5O2 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 1-[6-(3,4-dihydro-2H-quinolin-1-yl)-5-nitropyrimidin-4-yl]-3,4-dihydro-2H-quinoline |
| SMILES | O=[N+]([O-])c1c(N2CCCc3ccccc32)ncnc1N1CCCc2ccccc21 |
| InChI | InChI=1S/C22H21N5O2/c28-27(29)20-21(25-13-5-9-16-7-1-3-11-18(16)25)23-15-24-22(20)26-14-6-10-17-8-2-4-12-19(17)26/h1-4,7-8,11-12,15H,5-6,9-10,13-14H2 |
| InChIKey | WFBAETYMZNVGTN-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 75.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|