C17H19N5O2 — CID 23481699
1-(5-nitro-6-piperidin-1-ylpyrimidin-4-yl)-2,3-dihydroindole (PubChem CID 23481699) has the molecular formula C17H19N5O2 and a molecular weight of 325.37 g/mol. Its IUPAC name is 1-(5-nitro-6-piperidin-1-ylpyrimidin-4-yl)-2,3-dihydroindole.
| Compound Name | 1-(5-nitro-6-piperidin-1-ylpyrimidin-4-yl)-2,3-dihydroindole |
|---|---|
| PubChem CID | 23481699 |
| Molecular Formula | C17H19N5O2 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 1-(5-nitro-6-piperidin-1-ylpyrimidin-4-yl)-2,3-dihydroindole |
| SMILES | O=[N+]([O-])c1c(N2CCCCC2)ncnc1N1CCc2ccccc21 |
| InChI | InChI=1S/C17H19N5O2/c23-22(24)15-16(20-9-4-1-5-10-20)18-12-19-17(15)21-11-8-13-6-2-3-7-14(13)21/h2-3,6-7,12H,1,4-5,8-11H2 |
| InChIKey | ZWSHWYZIYLLWGK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 75.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|