C20H17ClN4O3 — CID 23481841
1-[6-(4-chloro-3,5-dimethylphenoxy)-5-nitropyrimidin-4-yl]-2,3-dihydroindole (PubChem CID 23481841) has the molecular formula C20H17ClN4O3 and a molecular weight of 396.83 g/mol. Its IUPAC name is 1-[6-(4-chloro-3,5-dimethylphenoxy)-5-nitropyrimidin-4-yl]-2,3-dihydroindole.
| Compound Name | 1-[6-(4-chloro-3,5-dimethylphenoxy)-5-nitropyrimidin-4-yl]-2,3-dihydroindole |
|---|---|
| PubChem CID | 23481841 |
| Molecular Formula | C20H17ClN4O3 |
| Molecular Weight | 396.83 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 1-[6-(4-chloro-3,5-dimethylphenoxy)-5-nitropyrimidin-4-yl]-2,3-dihydroindole |
| SMILES | Cc1cc(Oc2ncnc(N3CCc4ccccc43)c2[N+](=O)[O-])cc(C)c1Cl |
| InChI | InChI=1S/C20H17ClN4O3/c1-12-9-15(10-13(2)17(12)21)28-20-18(25(26)27)19(22-11-23-20)24-8-7-14-5-3-4-6-16(14)24/h3-6,9-11H,7-8H2,1-2H3 |
| InChIKey | XQIRKXYYSZILOY-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 81.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.83 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|