C20H23ClN4O5 — CID 23494221
ethyl 1-[6-(4-chloro-3,5-dimethylphenoxy)-5-nitropyrimidin-4-yl]piperidine-4-carboxylate (PubChem CID 23494221) has the molecular formula C20H23ClN4O5 and a molecular weight of 434.88 g/mol. Its IUPAC name is ethyl 1-[6-(4-chloro-3,5-dimethylphenoxy)-5-nitropyrimidin-4-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[6-(4-chloro-3,5-dimethylphenoxy)-5-nitropyrimidin-4-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 23494221 |
| Molecular Formula | C20H23ClN4O5 |
| Molecular Weight | 434.88 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | ethyl 1-[6-(4-chloro-3,5-dimethylphenoxy)-5-nitropyrimidin-4-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2ncnc(Oc3cc(C)c(Cl)c(C)c3)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C20H23ClN4O5/c1-4-29-20(26)14-5-7-24(8-6-14)18-17(25(27)28)19(23-11-22-18)30-15-9-12(2)16(21)13(3)10-15/h9-11,14H,4-8H2,1-3H3 |
| InChIKey | RIWCYBLUDIIFPL-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 107.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.88 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|