C16H25N5O5 — CID 23493102
ethyl 1-[6-[ethyl(2-hydroxyethyl)amino]-5-nitropyrimidin-4-yl]piperidine-4-carboxylate (PubChem CID 23493102) has the molecular formula C16H25N5O5 and a molecular weight of 367.41 g/mol. Its IUPAC name is ethyl 1-[6-[ethyl(2-hydroxyethyl)amino]-5-nitropyrimidin-4-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[6-[ethyl(2-hydroxyethyl)amino]-5-nitropyrimidin-4-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 23493102 |
| Molecular Formula | C16H25N5O5 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | ethyl 1-[6-[ethyl(2-hydroxyethyl)amino]-5-nitropyrimidin-4-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2ncnc(N(CC)CCO)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C16H25N5O5/c1-3-19(9-10-22)14-13(21(24)25)15(18-11-17-14)20-7-5-12(6-8-20)16(23)26-4-2/h11-12,22H,3-10H2,1-2H3 |
| InChIKey | WTJFNCVONQXTMA-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 121.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|