C24H25N5O6S — CID 67117437
ethyl 1-[6-[N-(benzenesulfonyl)anilino]-5-nitropyrimidin-4-yl]piperidine-4-carboxylate (PubChem CID 67117437) has the molecular formula C24H25N5O6S and a molecular weight of 511.56 g/mol. Its IUPAC name is ethyl 1-[6-[N-(benzenesulfonyl)anilino]-5-nitropyrimidin-4-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[6-[N-(benzenesulfonyl)anilino]-5-nitropyrimidin-4-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 67117437 |
| Molecular Formula | C24H25N5O6S |
| Molecular Weight | 511.56 g/mol |
| Exact Mass | 511.15 |
| IUPAC Name | ethyl 1-[6-[N-(benzenesulfonyl)anilino]-5-nitropyrimidin-4-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2ncnc(N(c3ccccc3)S(=O)(=O)c3ccccc3)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C24H25N5O6S/c1-2-35-24(30)18-13-15-27(16-14-18)22-21(29(31)32)23(26-17-25-22)28(19-9-5-3-6-10-19)36(33,34)20-11-7-4-8-12-20/h3-12,17-18H,2,13-16H2,1H3 |
| InChIKey | CTPQTYYYOZZBBA-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 135.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.56 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|