C24H25N5O7S — CID 69376665
[1-[6-[4-(benzenesulfonyl)anilino]-5-nitropyrimidin-4-yl]piperidin-4-yl] ethyl carbonate (PubChem CID 69376665) has the molecular formula C24H25N5O7S and a molecular weight of 527.56 g/mol. Its IUPAC name is [1-[6-[4-(benzenesulfonyl)anilino]-5-nitropyrimidin-4-yl]piperidin-4-yl] ethyl carbonate.
| Compound Name | [1-[6-[4-(benzenesulfonyl)anilino]-5-nitropyrimidin-4-yl]piperidin-4-yl] ethyl carbonate |
|---|---|
| PubChem CID | 69376665 |
| Molecular Formula | C24H25N5O7S |
| Molecular Weight | 527.56 g/mol |
| Exact Mass | 527.15 |
| IUPAC Name | [1-[6-[4-(benzenesulfonyl)anilino]-5-nitropyrimidin-4-yl]piperidin-4-yl] ethyl carbonate |
| SMILES | CCOC(=O)OC1CCN(c2ncnc(Nc3ccc(S(=O)(=O)c4ccccc4)cc3)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C24H25N5O7S/c1-2-35-24(30)36-18-12-14-28(15-13-18)23-21(29(31)32)22(25-16-26-23)27-17-8-10-20(11-9-17)37(33,34)19-6-4-3-5-7-19/h3-11,16,18H,2,12-15H2,1H3,(H,25,26,27) |
| InChIKey | LOPYMMPXPZKRTH-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 153.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.56 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|