C19H22FN5O5 — CID 69377157
ethyl [1-[6-(2-fluoro-N-methylanilino)-5-nitropyrimidin-4-yl]piperidin-4-yl] carbonate (PubChem CID 69377157) has the molecular formula C19H22FN5O5 and a molecular weight of 419.41 g/mol. Its IUPAC name is ethyl [1-[6-(2-fluoro-N-methylanilino)-5-nitropyrimidin-4-yl]piperidin-4-yl] carbonate.
| Compound Name | ethyl [1-[6-(2-fluoro-N-methylanilino)-5-nitropyrimidin-4-yl]piperidin-4-yl] carbonate |
|---|---|
| PubChem CID | 69377157 |
| Molecular Formula | C19H22FN5O5 |
| Molecular Weight | 419.41 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | ethyl [1-[6-(2-fluoro-N-methylanilino)-5-nitropyrimidin-4-yl]piperidin-4-yl] carbonate |
| SMILES | CCOC(=O)OC1CCN(c2ncnc(N(C)c3ccccc3F)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C19H22FN5O5/c1-3-29-19(26)30-13-8-10-24(11-9-13)18-16(25(27)28)17(21-12-22-18)23(2)15-7-5-4-6-14(15)20/h4-7,12-13H,3,8-11H2,1-2H3 |
| InChIKey | ZVKSRERPWNCCLU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 110.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|