C25H24N4O7 — CID 69377409
[1-[6-(4-benzoylphenoxy)-5-nitropyrimidin-4-yl]piperidin-4-yl] ethyl carbonate (PubChem CID 69377409) has the molecular formula C25H24N4O7 and a molecular weight of 492.49 g/mol. Its IUPAC name is [1-[6-(4-benzoylphenoxy)-5-nitropyrimidin-4-yl]piperidin-4-yl] ethyl carbonate.
| Compound Name | [1-[6-(4-benzoylphenoxy)-5-nitropyrimidin-4-yl]piperidin-4-yl] ethyl carbonate |
|---|---|
| PubChem CID | 69377409 |
| Molecular Formula | C25H24N4O7 |
| Molecular Weight | 492.49 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | [1-[6-(4-benzoylphenoxy)-5-nitropyrimidin-4-yl]piperidin-4-yl] ethyl carbonate |
| SMILES | CCOC(=O)OC1CCN(c2ncnc(Oc3ccc(C(=O)c4ccccc4)cc3)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C25H24N4O7/c1-2-34-25(31)36-20-12-14-28(15-13-20)23-21(29(32)33)24(27-16-26-23)35-19-10-8-18(9-11-19)22(30)17-6-4-3-5-7-17/h3-11,16,20H,2,12-15H2,1H3 |
| InChIKey | KAMJPVCNTKHAHU-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 133.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.49 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|