C21H22N6O7 — CID 10322477
ethyl 1-[6-[4-(2,5-dioxoimidazolidin-4-yl)phenoxy]-5-nitropyrimidin-4-yl]piperidine-4-carboxylate (PubChem CID 10322477) has the molecular formula C21H22N6O7 and a molecular weight of 470.44 g/mol. Its IUPAC name is ethyl 1-[6-[4-(2,5-dioxoimidazolidin-4-yl)phenoxy]-5-nitropyrimidin-4-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[6-[4-(2,5-dioxoimidazolidin-4-yl)phenoxy]-5-nitropyrimidin-4-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 10322477 |
| Molecular Formula | C21H22N6O7 |
| Molecular Weight | 470.44 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | ethyl 1-[6-[4-(2,5-dioxoimidazolidin-4-yl)phenoxy]-5-nitropyrimidin-4-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2ncnc(Oc3ccc(C4NC(=O)NC4=O)cc3)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C21H22N6O7/c1-2-33-20(29)13-7-9-26(10-8-13)17-16(27(31)32)19(23-11-22-17)34-14-5-3-12(4-6-14)15-18(28)25-21(30)24-15/h3-6,11,13,15H,2,7-10H2,1H3,(H2,24,25,28,30) |
| InChIKey | USWBOYMNSYZWNF-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 165.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.44 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|