C22H21ClN6O5 — CID 6413176
ethyl 1-[6-(6-chloro-3-phenylpyridazin-4-yl)oxy-5-nitropyrimidin-4-yl]piperidine-4-carboxylate (PubChem CID 6413176) has the molecular formula C22H21ClN6O5 and a molecular weight of 484.90 g/mol. Its IUPAC name is ethyl 1-[6-(6-chloro-3-phenylpyridazin-4-yl)oxy-5-nitropyrimidin-4-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[6-(6-chloro-3-phenylpyridazin-4-yl)oxy-5-nitropyrimidin-4-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 6413176 |
| Molecular Formula | C22H21ClN6O5 |
| Molecular Weight | 484.90 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | ethyl 1-[6-(6-chloro-3-phenylpyridazin-4-yl)oxy-5-nitropyrimidin-4-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2ncnc(Oc3cc(Cl)nnc3-c3ccccc3)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C22H21ClN6O5/c1-2-33-22(30)15-8-10-28(11-9-15)20-19(29(31)32)21(25-13-24-20)34-16-12-17(23)26-27-18(16)14-6-4-3-5-7-14/h3-7,12-13,15H,2,8-11H2,1H3 |
| InChIKey | PRRZYFYCCOQEHA-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 133.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.90 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|