C24H25N5O6S — CID 58216475
ethyl 1-[6-[4-(benzenesulfonyl)anilino]-5-nitropyrimidin-4-yl]piperidine-4-carboxylate (PubChem CID 58216475) has the molecular formula C24H25N5O6S and a molecular weight of 511.56 g/mol. Its IUPAC name is ethyl 1-[6-[4-(benzenesulfonyl)anilino]-5-nitropyrimidin-4-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[6-[4-(benzenesulfonyl)anilino]-5-nitropyrimidin-4-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 58216475 |
| Molecular Formula | C24H25N5O6S |
| Molecular Weight | 511.56 g/mol |
| Exact Mass | 511.15 |
| IUPAC Name | ethyl 1-[6-[4-(benzenesulfonyl)anilino]-5-nitropyrimidin-4-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2ncnc(Nc3ccc(S(=O)(=O)c4ccccc4)cc3)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C24H25N5O6S/c1-2-35-24(30)17-12-14-28(15-13-17)23-21(29(31)32)22(25-16-26-23)27-18-8-10-20(11-9-18)36(33,34)19-6-4-3-5-7-19/h3-11,16-17H,2,12-15H2,1H3,(H,25,26,27) |
| InChIKey | WAAYNEGHGFKAJM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 144.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.56 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|