C20H25N5O4 — CID 141107715
1-[6-(4-butan-2-ylanilino)-5-nitropyrimidin-4-yl]piperidine-4-carboxylic acid (PubChem CID 141107715) has the molecular formula C20H25N5O4 and a molecular weight of 399.45 g/mol. Its IUPAC name is 1-[6-(4-butan-2-ylanilino)-5-nitropyrimidin-4-yl]piperidine-4-carboxylic acid.
| Compound Name | 1-[6-(4-butan-2-ylanilino)-5-nitropyrimidin-4-yl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 141107715 |
| Molecular Formula | C20H25N5O4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 1-[6-(4-butan-2-ylanilino)-5-nitropyrimidin-4-yl]piperidine-4-carboxylic acid |
| SMILES | CCC(C)c1ccc(Nc2ncnc(N3CCC(C(=O)O)CC3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H25N5O4/c1-3-13(2)14-4-6-16(7-5-14)23-18-17(25(28)29)19(22-12-21-18)24-10-8-15(9-11-24)20(26)27/h4-7,12-13,15H,3,8-11H2,1-2H3,(H,26,27)(H,21,22,23) |
| InChIKey | VGEJNFAWYWIYNV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 121.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|