C18H19F2N5O4 — CID 69377070
1-[6-[[4-(difluoromethyl)phenyl]methylamino]-5-nitropyrimidin-4-yl]piperidine-4-carboxylic acid (PubChem CID 69377070) has the molecular formula C18H19F2N5O4 and a molecular weight of 407.38 g/mol. Its IUPAC name is 1-[6-[[4-(difluoromethyl)phenyl]methylamino]-5-nitropyrimidin-4-yl]piperidine-4-carboxylic acid.
| Compound Name | 1-[6-[[4-(difluoromethyl)phenyl]methylamino]-5-nitropyrimidin-4-yl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 69377070 |
| Molecular Formula | C18H19F2N5O4 |
| Molecular Weight | 407.38 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | 1-[6-[[4-(difluoromethyl)phenyl]methylamino]-5-nitropyrimidin-4-yl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(c2ncnc(NCc3ccc(C(F)F)cc3)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C18H19F2N5O4/c19-15(20)12-3-1-11(2-4-12)9-21-16-14(25(28)29)17(23-10-22-16)24-7-5-13(6-8-24)18(26)27/h1-4,10,13,15H,5-9H2,(H,26,27)(H,21,22,23) |
| InChIKey | YYVKSDWUIHBCTQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 121.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|