C20H23F2N5O5 — CID 3332009
ethyl 1-[6-[[2-(difluoromethoxy)phenyl]methylamino]-5-nitropyrimidin-4-yl]piperidine-4-carboxylate (PubChem CID 3332009) has the molecular formula C20H23F2N5O5 and a molecular weight of 451.43 g/mol. Its IUPAC name is ethyl 1-[6-[[2-(difluoromethoxy)phenyl]methylamino]-5-nitropyrimidin-4-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[6-[[2-(difluoromethoxy)phenyl]methylamino]-5-nitropyrimidin-4-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 3332009 |
| Molecular Formula | C20H23F2N5O5 |
| Molecular Weight | 451.43 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | ethyl 1-[6-[[2-(difluoromethoxy)phenyl]methylamino]-5-nitropyrimidin-4-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2ncnc(NCc3ccccc3OC(F)F)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C20H23F2N5O5/c1-2-31-19(28)13-7-9-26(10-8-13)18-16(27(29)30)17(24-12-25-18)23-11-14-5-3-4-6-15(14)32-20(21)22/h3-6,12-13,20H,2,7-11H2,1H3,(H,23,24,25) |
| InChIKey | NLYLAPLDTRRJKY-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 119.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|