C21H34N6O4 — CID 23494134
ethyl 1-[5-nitro-6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyrimidin-4-yl]piperidine-4-carboxylate (PubChem CID 23494134) has the molecular formula C21H34N6O4 and a molecular weight of 434.54 g/mol. Its IUPAC name is ethyl 1-[5-nitro-6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyrimidin-4-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[5-nitro-6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyrimidin-4-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 23494134 |
| Molecular Formula | C21H34N6O4 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | ethyl 1-[5-nitro-6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyrimidin-4-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2ncnc(NC3CC(C)(C)NC(C)(C)C3)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C21H34N6O4/c1-6-31-19(28)14-7-9-26(10-8-14)18-16(27(29)30)17(22-13-23-18)24-15-11-20(2,3)25-21(4,5)12-15/h13-15,25H,6-12H2,1-5H3,(H,22,23,24) |
| InChIKey | ASCCDGSNMZXEKA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|