C20H34N6O2 — CID 23492439
6-(2-ethylpiperidin-1-yl)-5-nitro-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrimidin-4-amine (PubChem CID 23492439) has the molecular formula C20H34N6O2 and a molecular weight of 390.53 g/mol. Its IUPAC name is 6-(2-ethylpiperidin-1-yl)-5-nitro-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrimidin-4-amine.
| Compound Name | 6-(2-ethylpiperidin-1-yl)-5-nitro-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 23492439 |
| Molecular Formula | C20H34N6O2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.27 |
| IUPAC Name | 6-(2-ethylpiperidin-1-yl)-5-nitro-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrimidin-4-amine |
| SMILES | CCC1CCCCN1c1ncnc(NC2CC(C)(C)NC(C)(C)C2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C20H34N6O2/c1-6-15-9-7-8-10-25(15)18-16(26(27)28)17(21-13-22-18)23-14-11-19(2,3)24-20(4,5)12-14/h13-15,24H,6-12H2,1-5H3,(H,21,22,23) |
| InChIKey | KGORLAGONBUSBC-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|