C23H32ClN7O2 — CID 23491020
6-[4-(3-chlorophenyl)piperazin-1-yl]-5-nitro-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrimidin-4-amine (PubChem CID 23491020) has the molecular formula C23H32ClN7O2 and a molecular weight of 474.01 g/mol. Its IUPAC name is 6-[4-(3-chlorophenyl)piperazin-1-yl]-5-nitro-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrimidin-4-amine.
| Compound Name | 6-[4-(3-chlorophenyl)piperazin-1-yl]-5-nitro-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 23491020 |
| Molecular Formula | C23H32ClN7O2 |
| Molecular Weight | 474.01 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | 6-[4-(3-chlorophenyl)piperazin-1-yl]-5-nitro-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrimidin-4-amine |
| SMILES | CC1(C)CC(Nc2ncnc(N3CCN(c4cccc(Cl)c4)CC3)c2[N+](=O)[O-])CC(C)(C)N1 |
| InChI | InChI=1S/C23H32ClN7O2/c1-22(2)13-17(14-23(3,4)28-22)27-20-19(31(32)33)21(26-15-25-20)30-10-8-29(9-11-30)18-7-5-6-16(24)12-18/h5-7,12,15,17,28H,8-11,13-14H2,1-4H3,(H,25,26,27) |
| InChIKey | ZUKCBQJWWRJLAC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.01 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|