C23H31ClN4O2 — CID 53369682
3-[4-(3-chlorophenyl)piperazin-1-yl]-4-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]cyclobut-3-ene-1,2-dione (PubChem CID 53369682) has the molecular formula C23H31ClN4O2 and a molecular weight of 430.98 g/mol. Its IUPAC name is 3-[4-(3-chlorophenyl)piperazin-1-yl]-4-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[4-(3-chlorophenyl)piperazin-1-yl]-4-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 53369682 |
| Molecular Formula | C23H31ClN4O2 |
| Molecular Weight | 430.98 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | 3-[4-(3-chlorophenyl)piperazin-1-yl]-4-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]cyclobut-3-ene-1,2-dione |
| SMILES | CC1(C)CC(Nc2c(N3CCN(c4cccc(Cl)c4)CC3)c(=O)c2=O)CC(C)(C)N1 |
| InChI | InChI=1S/C23H31ClN4O2/c1-22(2)13-16(14-23(3,4)26-22)25-18-19(21(30)20(18)29)28-10-8-27(9-11-28)17-7-5-6-15(24)12-17/h5-7,12,16,25-26H,8-11,13-14H2,1-4H3 |
| InChIKey | QFKDFZNTCAPSDC-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.98 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|