C23H32ClN3S — CID 7319831
N-[(1S)-1-(1-adamantyl)ethyl]-4-(3-chlorophenyl)piperazine-1-carbothioamide (PubChem CID 7319831) has the molecular formula C23H32ClN3S and a molecular weight of 418.05 g/mol. Its IUPAC name is N-[(1S)-1-(1-adamantyl)ethyl]-4-(3-chlorophenyl)piperazine-1-carbothioamide.
| Compound Name | N-[(1S)-1-(1-adamantyl)ethyl]-4-(3-chlorophenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 7319831 |
| Molecular Formula | C23H32ClN3S |
| Molecular Weight | 418.05 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | N-[(1S)-1-(1-adamantyl)ethyl]-4-(3-chlorophenyl)piperazine-1-carbothioamide |
| SMILES | C[C@H](NC(=S)N1CCN(c2cccc(Cl)c2)CC1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H32ClN3S/c1-16(23-13-17-9-18(14-23)11-19(10-17)15-23)25-22(28)27-7-5-26(6-8-27)21-4-2-3-20(24)12-21/h2-4,12,16-19H,5-11,13-15H2,1H3,(H,25,28)/t16-,17?,18?,19?,23?/m0/s1 |
| InChIKey | YIPMCWHVLVBGBE-LXGFQCHUSA-N |
| XLogP | 4.94 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.05 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|