C24H31ClN2O3 — CID 9018101
[2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl] 2-(1-adamantyl)acetate (PubChem CID 9018101) has the molecular formula C24H31ClN2O3 and a molecular weight of 430.98 g/mol. Its IUPAC name is [2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl] 2-(1-adamantyl)acetate.
| Compound Name | [2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl] 2-(1-adamantyl)acetate |
|---|---|
| PubChem CID | 9018101 |
| Molecular Formula | C24H31ClN2O3 |
| Molecular Weight | 430.98 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | [2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl] 2-(1-adamantyl)acetate |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)OCC(=O)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C24H31ClN2O3/c25-20-2-1-3-21(11-20)26-4-6-27(7-5-26)22(28)16-30-23(29)15-24-12-17-8-18(13-24)10-19(9-17)14-24/h1-3,11,17-19H,4-10,12-16H2 |
| InChIKey | CIGIOJVSYHRDTL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.98 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |